C9H16ClNO3S — CID 12781048
ethyl 2-[(2-chloroacetyl)amino]-4-methylsulfanylbutanoate (PubChem CID 12781048) has the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. Its IUPAC name is ethyl 2-[(2-chloroacetyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl 2-[(2-chloroacetyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 12781048 |
| Molecular Formula | C9H16ClNO3S |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | ethyl 2-[(2-chloroacetyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)C(CCSC)NC(=O)CCl |
| InChI | InChI=1S/C9H16ClNO3S/c1-3-14-9(13)7(4-5-15-2)11-8(12)6-10/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | HNDUWDRTMUKVEN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|