C13H26N2O5S — CID 110189660
ethyl (2S)-2-[[2,2-dimethoxyethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 110189660) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl (2S)-2-[[2,2-dimethoxyethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl (2S)-2-[[2,2-dimethoxyethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 110189660 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl (2S)-2-[[2,2-dimethoxyethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)[C@H](CCSC)NC(=O)N(C)CC(OC)OC |
| InChI | InChI=1S/C13H26N2O5S/c1-6-20-12(16)10(7-8-21-5)14-13(17)15(2)9-11(18-3)19-4/h10-11H,6-9H2,1-5H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | UUMNFNLRVHYCIA-JTQLQIEISA-N |
| XLogP | 0.93 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|