C9H18N2O3S — CID 104906564
(2R)-2-[[ethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 104906564) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R)-2-[[ethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[ethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104906564 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2R)-2-[[ethyl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCN(C)C(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C9H18N2O3S/c1-4-11(2)9(14)10-7(8(12)13)5-6-15-3/h7H,4-6H2,1-3H3,(H,10,14)(H,12,13)/t7-/m1/s1 |
| InChIKey | HEYMPZCSNPTPHT-SSDOTTSWSA-N |
| XLogP | 0.85 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |