C13H27N3O3S — CID 102995366
(2R)-2-[[3-(dimethylamino)propyl-ethylcarbamoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 102995366) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is (2R)-2-[[3-(dimethylamino)propyl-ethylcarbamoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[3-(dimethylamino)propyl-ethylcarbamoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 102995366 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (2R)-2-[[3-(dimethylamino)propyl-ethylcarbamoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCN(CCCN(C)C)C(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C13H27N3O3S/c1-5-16(9-6-8-15(2)3)13(19)14-11(12(17)18)7-10-20-4/h11H,5-10H2,1-4H3,(H,14,19)(H,17,18)/t11-/m1/s1 |
| InChIKey | AMFFTLNSCPKJPU-LLVKDONJSA-N |
| XLogP | 1.18 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |