C23H26N2O6S — CID 18645306
(2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-4-anilinopentanedioic acid (PubChem CID 18645306) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-4-anilinopentanedioic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-4-anilinopentanedioic acid |
|---|---|
| PubChem CID | 18645306 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]-4-anilinopentanedioic acid |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)N[C@@H](CC(Nc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H26N2O6S/c1-15(26)32-14-17(12-16-8-4-2-5-9-16)21(27)25-20(23(30)31)13-19(22(28)29)24-18-10-6-3-7-11-18/h2-11,17,19-20,24H,12-14H2,1H3,(H,25,27)(H,28,29)(H,30,31)/t17?,19?,20-/m0/s1 |
| InChIKey | UVFAAWDZASRZPS-UUKMXZOPSA-N |
| XLogP | 2.65 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|