C17H23NO4S — CID 18984331
5-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]pentanoic acid (PubChem CID 18984331) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 5-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]pentanoic acid.
| Compound Name | 5-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18984331 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5-[[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]amino]pentanoic acid |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C17H23NO4S/c1-13(19)23-12-15(11-14-7-3-2-4-8-14)17(22)18-10-6-5-9-16(20)21/h2-4,7-8,15H,5-6,9-12H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | UAOSAZMKYSWWOX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|