C16H23NO5S2 — CID 15120760
2-[[2-(acetylsulfanylmethyl)-5-phenylpentanoyl]amino]ethanesulfonic acid (PubChem CID 15120760) has the molecular formula C16H23NO5S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[[2-(acetylsulfanylmethyl)-5-phenylpentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-(acetylsulfanylmethyl)-5-phenylpentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 15120760 |
| Molecular Formula | C16H23NO5S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-[[2-(acetylsulfanylmethyl)-5-phenylpentanoyl]amino]ethanesulfonic acid |
| SMILES | CC(=O)SCC(CCCc1ccccc1)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C16H23NO5S2/c1-13(18)23-12-15(16(19)17-10-11-24(20,21)22)9-5-8-14-6-3-2-4-7-14/h2-4,6-7,15H,5,8-12H2,1H3,(H,17,19)(H,20,21,22) |
| InChIKey | XLLVRLOJFKHARD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|