C24H29NO4S — CID 139831324
(2R)-2-[[(2R)-2-(acetylsulfanylmethyl)-7-phenylheptanoyl]amino]-2-phenylacetic acid (PubChem CID 139831324) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(acetylsulfanylmethyl)-7-phenylheptanoyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[(2R)-2-(acetylsulfanylmethyl)-7-phenylheptanoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 139831324 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (2R)-2-[[(2R)-2-(acetylsulfanylmethyl)-7-phenylheptanoyl]amino]-2-phenylacetic acid |
| SMILES | CC(=O)SC[C@H](CCCCCc1ccccc1)C(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO4S/c1-18(26)30-17-21(16-10-3-7-13-19-11-5-2-6-12-19)23(27)25-22(24(28)29)20-14-8-4-9-15-20/h2,4-6,8-9,11-12,14-15,21-22H,3,7,10,13,16-17H2,1H3,(H,25,27)(H,28,29)/t21-,22+/m0/s1 |
| InChIKey | ZPEHFWGVOZJEJC-FCHUYYIVSA-N |
| XLogP | 4.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|