About S-(3-phenylpropyl) ethanethioate
S-(3-phenylpropyl) ethanethioate (PubChem CID 11008825) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is S-(3-phenylpropyl) ethanethioate.
Molecular Properties
| Compound Name | S-(3-phenylpropyl) ethanethioate |
| PubChem CID | 11008825 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | S-(3-phenylpropyl) ethanethioate |
| SMILES | CC(=O)SCCCc1ccccc1 |
| InChI | InChI=1S/C11H14OS/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | XZVDJNOEWVWQTL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-phenylpropyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-phenylpropyl) ethanethioate?
The IUPAC name of S-(3-phenylpropyl) ethanethioate (CID 11008825) is S-(3-phenylpropyl) ethanethioate.
What is the SMILES notation for S-(3-phenylpropyl) ethanethioate?
The canonical SMILES for S-(3-phenylpropyl) ethanethioate is CC(=O)SCCCc1ccccc1.
What is the InChIKey of S-(3-phenylpropyl) ethanethioate?
The InChIKey is XZVDJNOEWVWQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3.
What are the key properties of S-(3-phenylpropyl) ethanethioate?
S-(3-phenylpropyl) ethanethioate has a molecular weight of 194.30 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-phenylpropyl) ethanethioate is sourced from PubChem (CID 11008825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).