About 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate
1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate (PubChem CID 87718174) has the molecular formula C22H26O4S
and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate.
Molecular Properties
| Compound Name | 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate |
| PubChem CID | 87718174 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate |
| SMILES | CC(=O)SCC(=O)CCc1ccccc1.O=C(CO)CCc1ccccc1 |
| InChI | InChI=1S/C12H14O2S.C10H12O2/c1-10(13)15-9-12(14)8-7-11-5-3-2-4-6-11;11-8-10(12)7-6-9-4-2-1-3-5-9/h2-6H,7-9H2,1H3;1-5,11H,6-8H2 |
| InChIKey | CGCQDCJTXHHZTE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate?
The IUPAC name of 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate (CID 87718174) is 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate.
What is the SMILES notation for 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate?
The canonical SMILES for 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate is CC(=O)SCC(=O)CCc1ccccc1.O=C(CO)CCc1ccccc1.
What is the InChIKey of 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate?
The InChIKey is CGCQDCJTXHHZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2S.C10H12O2/c1-10(13)15-9-12(14)8-7-11-5-3-2-4-6-11;11-8-10(12)7-6-9-4-2-1-3-5-9/h2-6H,7-9H2,1H3;1-5,11H,6-8H2.
What are the key properties of 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate?
1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate has a molecular weight of 386.51 g/mol, XLogP of 3.65, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-4-phenylbutan-2-one;S-(2-oxo-4-phenylbutyl) ethanethioate is sourced from PubChem (CID 87718174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).