About methanamine;1-phenylpentan-3-one
methanamine;1-phenylpentan-3-one (PubChem CID 167492251) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is methanamine;1-phenylpentan-3-one.
Molecular Properties
| Compound Name | methanamine;1-phenylpentan-3-one |
| PubChem CID | 167492251 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | methanamine;1-phenylpentan-3-one |
| SMILES | CCC(=O)CCc1ccccc1.CN |
| InChI | InChI=1S/C11H14O.CH5N/c1-2-11(12)9-8-10-6-4-3-5-7-10;1-2/h3-7H,2,8-9H2,1H3;2H2,1H3 |
| InChIKey | UZEVEBLLXXAZED-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;1-phenylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-phenylpentan-3-one?
The IUPAC name of methanamine;1-phenylpentan-3-one (CID 167492251) is methanamine;1-phenylpentan-3-one.
What is the SMILES notation for methanamine;1-phenylpentan-3-one?
The canonical SMILES for methanamine;1-phenylpentan-3-one is CCC(=O)CCc1ccccc1.CN.
What is the InChIKey of methanamine;1-phenylpentan-3-one?
The InChIKey is UZEVEBLLXXAZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O.CH5N/c1-2-11(12)9-8-10-6-4-3-5-7-10;1-2/h3-7H,2,8-9H2,1H3;2H2,1H3.
What are the key properties of methanamine;1-phenylpentan-3-one?
methanamine;1-phenylpentan-3-one has a molecular weight of 193.29 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-phenylpentan-3-one is sourced from PubChem (CID 167492251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).