About carbonic acid;3-phenylpropanamide
carbonic acid;3-phenylpropanamide (PubChem CID 174965682) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is carbonic acid;3-phenylpropanamide.
Molecular Properties
| Compound Name | carbonic acid;3-phenylpropanamide |
| PubChem CID | 174965682 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | carbonic acid;3-phenylpropanamide |
| SMILES | NC(=O)CCc1ccccc1.O=C(O)O |
| InChI | InChI=1S/C9H11NO.CH2O3/c10-9(11)7-6-8-4-2-1-3-5-8;2-1(3)4/h1-5H,6-7H2,(H2,10,11);(H2,2,3,4) |
| InChIKey | SGYPLJXJTIHACZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbonic acid;3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;3-phenylpropanamide?
The IUPAC name of carbonic acid;3-phenylpropanamide (CID 174965682) is carbonic acid;3-phenylpropanamide.
What is the SMILES notation for carbonic acid;3-phenylpropanamide?
The canonical SMILES for carbonic acid;3-phenylpropanamide is NC(=O)CCc1ccccc1.O=C(O)O.
What is the InChIKey of carbonic acid;3-phenylpropanamide?
The InChIKey is SGYPLJXJTIHACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.CH2O3/c10-9(11)7-6-8-4-2-1-3-5-8;2-1(3)4/h1-5H,6-7H2,(H2,10,11);(H2,2,3,4).
What are the key properties of carbonic acid;3-phenylpropanamide?
carbonic acid;3-phenylpropanamide has a molecular weight of 211.22 g/mol, XLogP of 1.33, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;3-phenylpropanamide is sourced from PubChem (CID 174965682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).