About carbanide;3-phenylpropanamide;yttrium
carbanide;3-phenylpropanamide;yttrium (PubChem CID 160557542) has the molecular formula C10H14NOY-
and a molecular weight of 253.13 g/mol. Its IUPAC name is carbanide;3-phenylpropanamide;yttrium.
Molecular Properties
| Compound Name | carbanide;3-phenylpropanamide;yttrium |
| PubChem CID | 160557542 |
| Molecular Formula | C10H14NOY- |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | carbanide;3-phenylpropanamide;yttrium |
| SMILES | NC(=O)CCc1ccccc1.[CH3-].[Y] |
| InChI | InChI=1S/C9H11NO.CH3.Y/c10-9(11)7-6-8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H2,10,11);1H3;/q;-1; |
| InChIKey | KZTDHPRJPABZCK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;3-phenylpropanamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;3-phenylpropanamide;yttrium?
The IUPAC name of carbanide;3-phenylpropanamide;yttrium (CID 160557542) is carbanide;3-phenylpropanamide;yttrium.
What is the SMILES notation for carbanide;3-phenylpropanamide;yttrium?
The canonical SMILES for carbanide;3-phenylpropanamide;yttrium is NC(=O)CCc1ccccc1.[CH3-].[Y].
What is the InChIKey of carbanide;3-phenylpropanamide;yttrium?
The InChIKey is KZTDHPRJPABZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.CH3.Y/c10-9(11)7-6-8-4-2-1-3-5-8;;/h1-5H,6-7H2,(H2,10,11);1H3;/q;-1;.
What are the key properties of carbanide;3-phenylpropanamide;yttrium?
carbanide;3-phenylpropanamide;yttrium has a molecular weight of 253.13 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;3-phenylpropanamide;yttrium is sourced from PubChem (CID 160557542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).