C20H27NOS — CID 15667483
7-[5-(3-phenylpropyl)thiophen-2-yl]heptanamide (PubChem CID 15667483) has the molecular formula C20H27NOS and a molecular weight of 329.51 g/mol. Its IUPAC name is 7-[5-(3-phenylpropyl)thiophen-2-yl]heptanamide.
| Compound Name | 7-[5-(3-phenylpropyl)thiophen-2-yl]heptanamide |
|---|---|
| PubChem CID | 15667483 |
| Molecular Formula | C20H27NOS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 7-[5-(3-phenylpropyl)thiophen-2-yl]heptanamide |
| SMILES | NC(=O)CCCCCCc1ccc(CCCc2ccccc2)s1 |
| InChI | InChI=1S/C20H27NOS/c21-20(22)14-7-2-1-6-12-18-15-16-19(23-18)13-8-11-17-9-4-3-5-10-17/h3-5,9-10,15-16H,1-2,6-8,11-14H2,(H2,21,22) |
| InChIKey | OANMCFQJZWJXEL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|