C22H30O2S — CID 15667459
2,2-dimethyl-7-[5-(3-phenylpropyl)thiophen-2-yl]heptanoic acid (PubChem CID 15667459) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is 2,2-dimethyl-7-[5-(3-phenylpropyl)thiophen-2-yl]heptanoic acid.
| Compound Name | 2,2-dimethyl-7-[5-(3-phenylpropyl)thiophen-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 15667459 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2,2-dimethyl-7-[5-(3-phenylpropyl)thiophen-2-yl]heptanoic acid |
| SMILES | CC(C)(CCCCCc1ccc(CCCc2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C22H30O2S/c1-22(2,21(23)24)17-8-4-7-13-19-15-16-20(25-19)14-9-12-18-10-5-3-6-11-18/h3,5-6,10-11,15-16H,4,7-9,12-14,17H2,1-2H3,(H,23,24) |
| InChIKey | CNJIOUGCYDIJDS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|