C17H27NO — CID 142211557
N,N,2,2-tetramethyl-7-phenylheptanamide (PubChem CID 142211557) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-7-phenylheptanamide.
| Compound Name | N,N,2,2-tetramethyl-7-phenylheptanamide |
|---|---|
| PubChem CID | 142211557 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N,N,2,2-tetramethyl-7-phenylheptanamide |
| SMILES | CN(C)C(=O)C(C)(C)CCCCCc1ccccc1 |
| InChI | InChI=1S/C17H27NO/c1-17(2,16(19)18(3)4)14-10-6-9-13-15-11-7-5-8-12-15/h5,7-8,11-12H,6,9-10,13-14H2,1-4H3 |
| InChIKey | QQMPMQZPPCZTOQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|