C15H22O — CID 13371233
2,2-dimethyl-7-phenylheptan-3-one (PubChem CID 13371233) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,2-dimethyl-7-phenylheptan-3-one.
| Compound Name | 2,2-dimethyl-7-phenylheptan-3-one |
|---|---|
| PubChem CID | 13371233 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2,2-dimethyl-7-phenylheptan-3-one |
| SMILES | CC(C)(C)C(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C15H22O/c1-15(2,3)14(16)12-8-7-11-13-9-5-4-6-10-13/h4-6,9-10H,7-8,11-12H2,1-3H3 |
| InChIKey | BQZFANPWECOSDL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|