About 5-phenylpentan-2-one
5-phenylpentan-2-one (PubChem CID 16701) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 5-phenylpentan-2-one.
Molecular Properties
| Compound Name | 5-phenylpentan-2-one |
| PubChem CID | 16701 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 5-phenylpentan-2-one |
| SMILES | CC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C11H14O/c1-10(12)6-5-9-11-7-3-2-4-8-11/h2-4,7-8H,5-6,9H2,1H3 |
| InChIKey | DGMYRPFYNFQCHM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-phenylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpentan-2-one?
The IUPAC name of 5-phenylpentan-2-one (CID 16701) is 5-phenylpentan-2-one.
What is the SMILES notation for 5-phenylpentan-2-one?
The canonical SMILES for 5-phenylpentan-2-one is CC(=O)CCCc1ccccc1.
What is the InChIKey of 5-phenylpentan-2-one?
The InChIKey is DGMYRPFYNFQCHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-10(12)6-5-9-11-7-3-2-4-8-11/h2-4,7-8H,5-6,9H2,1H3.
What are the key properties of 5-phenylpentan-2-one?
5-phenylpentan-2-one has a molecular weight of 162.23 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpentan-2-one is sourced from PubChem (CID 16701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).