About 5-methylhexan-2-one;4-phenylbutanamide
5-methylhexan-2-one;4-phenylbutanamide (PubChem CID 166139456) has the molecular formula C17H27NO2
and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-methylhexan-2-one;4-phenylbutanamide.
Molecular Properties
| Compound Name | 5-methylhexan-2-one;4-phenylbutanamide |
| PubChem CID | 166139456 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 5-methylhexan-2-one;4-phenylbutanamide |
| SMILES | CC(=O)CCC(C)C.NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C10H13NO.C7H14O/c11-10(12)8-4-7-9-5-2-1-3-6-9;1-6(2)4-5-7(3)8/h1-3,5-6H,4,7-8H2,(H2,11,12);6H,4-5H2,1-3H3 |
| InChIKey | KDJXZSNKJAVJMD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylhexan-2-one;4-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexan-2-one;4-phenylbutanamide?
The IUPAC name of 5-methylhexan-2-one;4-phenylbutanamide (CID 166139456) is 5-methylhexan-2-one;4-phenylbutanamide.
What is the SMILES notation for 5-methylhexan-2-one;4-phenylbutanamide?
The canonical SMILES for 5-methylhexan-2-one;4-phenylbutanamide is CC(=O)CCC(C)C.NC(=O)CCCc1ccccc1.
What is the InChIKey of 5-methylhexan-2-one;4-phenylbutanamide?
The InChIKey is KDJXZSNKJAVJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.C7H14O/c11-10(12)8-4-7-9-5-2-1-3-6-9;1-6(2)4-5-7(3)8/h1-3,5-6H,4,7-8H2,(H2,11,12);6H,4-5H2,1-3H3.
What are the key properties of 5-methylhexan-2-one;4-phenylbutanamide?
5-methylhexan-2-one;4-phenylbutanamide has a molecular weight of 277.41 g/mol, XLogP of 3.51, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexan-2-one;4-phenylbutanamide is sourced from PubChem (CID 166139456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).