About ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate
ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate (PubChem CID 174922594) has the molecular formula C19H30O4
and a molecular weight of 322.45 g/mol. Its IUPAC name is ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate |
| PubChem CID | 174922594 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate |
| SMILES | CCOC(=O)CCC(C)C.CCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H14O2.C8H16O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;1-4-10-8(9)6-5-7(2)3/h3-7H,2,8-9H2,1H3;7H,4-6H2,1-3H3 |
| InChIKey | CHTLPHGLTAYIQG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate?
The IUPAC name of ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate (CID 174922594) is ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate.
What is the SMILES notation for ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate?
The canonical SMILES for ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate is CCOC(=O)CCC(C)C.CCOC(=O)CCc1ccccc1.
What is the InChIKey of ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate?
The InChIKey is CHTLPHGLTAYIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C8H16O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10;1-4-10-8(9)6-5-7(2)3/h3-7H,2,8-9H2,1H3;7H,4-6H2,1-3H3.
What are the key properties of ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate?
ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate has a molecular weight of 322.45 g/mol, XLogP of 4.17, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methylpentanoate;ethyl 3-phenylpropanoate is sourced from PubChem (CID 174922594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).