About 4-phenylbutan-2-one;prop-1-ene
4-phenylbutan-2-one;prop-1-ene (PubChem CID 166128425) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-phenylbutan-2-one;prop-1-ene.
Molecular Properties
| Compound Name | 4-phenylbutan-2-one;prop-1-ene |
| PubChem CID | 166128425 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4-phenylbutan-2-one;prop-1-ene |
| SMILES | C=CC.CC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C10H12O.C3H6/c1-9(11)7-8-10-5-3-2-4-6-10;1-3-2/h2-6H,7-8H2,1H3;3H,1H2,2H3 |
| InChIKey | SZSRTCZTNSYNPB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbutan-2-one;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutan-2-one;prop-1-ene?
The IUPAC name of 4-phenylbutan-2-one;prop-1-ene (CID 166128425) is 4-phenylbutan-2-one;prop-1-ene.
What is the SMILES notation for 4-phenylbutan-2-one;prop-1-ene?
The canonical SMILES for 4-phenylbutan-2-one;prop-1-ene is C=CC.CC(=O)CCc1ccccc1.
What is the InChIKey of 4-phenylbutan-2-one;prop-1-ene?
The InChIKey is SZSRTCZTNSYNPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C3H6/c1-9(11)7-8-10-5-3-2-4-6-10;1-3-2/h2-6H,7-8H2,1H3;3H,1H2,2H3.
What are the key properties of 4-phenylbutan-2-one;prop-1-ene?
4-phenylbutan-2-one;prop-1-ene has a molecular weight of 190.29 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutan-2-one;prop-1-ene is sourced from PubChem (CID 166128425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).