About lanthanum;3-phenylpropanoic acid
lanthanum;3-phenylpropanoic acid (PubChem CID 174887955) has the molecular formula C9H10LaO2
and a molecular weight of 289.08 g/mol. Its IUPAC name is lanthanum;3-phenylpropanoic acid.
Molecular Properties
| Compound Name | lanthanum;3-phenylpropanoic acid |
| PubChem CID | 174887955 |
| Molecular Formula | C9H10LaO2 |
| Molecular Weight | 289.08 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | lanthanum;3-phenylpropanoic acid |
| SMILES | O=C(O)CCc1ccccc1.[La] |
| InChI | InChI=1S/C9H10O2.La/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H,10,11); |
| InChIKey | GGSYVMFZJDTPCX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.08 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lanthanum;3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;3-phenylpropanoic acid?
The IUPAC name of lanthanum;3-phenylpropanoic acid (CID 174887955) is lanthanum;3-phenylpropanoic acid.
What is the SMILES notation for lanthanum;3-phenylpropanoic acid?
The canonical SMILES for lanthanum;3-phenylpropanoic acid is O=C(O)CCc1ccccc1.[La].
What is the InChIKey of lanthanum;3-phenylpropanoic acid?
The InChIKey is GGSYVMFZJDTPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.La/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H,10,11);.
What are the key properties of lanthanum;3-phenylpropanoic acid?
lanthanum;3-phenylpropanoic acid has a molecular weight of 289.08 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;3-phenylpropanoic acid is sourced from PubChem (CID 174887955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).