C18H20O5 — CID 175603484
3-(3-hydroxyphenyl)propanoic acid;3-phenylpropanoic acid (PubChem CID 175603484) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)propanoic acid;3-phenylpropanoic acid.
| Compound Name | 3-(3-hydroxyphenyl)propanoic acid;3-phenylpropanoic acid |
|---|---|
| PubChem CID | 175603484 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-(3-hydroxyphenyl)propanoic acid;3-phenylpropanoic acid |
| SMILES | O=C(O)CCc1cccc(O)c1.O=C(O)CCc1ccccc1 |
| InChI | InChI=1S/C9H10O3.C9H10O2/c10-8-3-1-2-7(6-8)4-5-9(11)12;10-9(11)7-6-8-4-2-1-3-5-8/h1-3,6,10H,4-5H2,(H,11,12);1-5H,6-7H2,(H,10,11) |
| InChIKey | VUYKAPXJYQKUOR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |