C14H17NO6 — CID 25138178
(2R)-2-[3-(3-hydroxyphenyl)propanoylamino]pentanedioic acid (PubChem CID 25138178) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2R)-2-[3-(3-hydroxyphenyl)propanoylamino]pentanedioic acid.
| Compound Name | (2R)-2-[3-(3-hydroxyphenyl)propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 25138178 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2R)-2-[3-(3-hydroxyphenyl)propanoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](NC(=O)CCc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C14H17NO6/c16-10-3-1-2-9(8-10)4-6-12(17)15-11(14(20)21)5-7-13(18)19/h1-3,8,11,16H,4-7H2,(H,15,17)(H,18,19)(H,20,21)/t11-/m1/s1 |
| InChIKey | CIOUZWFDXXUDGL-LLVKDONJSA-N |
| XLogP | 0.76 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |