C26H31N3O8 — CID 123783597
6-amino-5-[[4-carboxy-2-[3-[4-(3-hydroxyphenyl)phenyl]propanoylamino]butanoyl]amino]-6-oxohexanoic acid (PubChem CID 123783597) has the molecular formula C26H31N3O8 and a molecular weight of 513.55 g/mol. Its IUPAC name is 6-amino-5-[[4-carboxy-2-[3-[4-(3-hydroxyphenyl)phenyl]propanoylamino]butanoyl]amino]-6-oxohexanoic acid.
| Compound Name | 6-amino-5-[[4-carboxy-2-[3-[4-(3-hydroxyphenyl)phenyl]propanoylamino]butanoyl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 123783597 |
| Molecular Formula | C26H31N3O8 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 6-amino-5-[[4-carboxy-2-[3-[4-(3-hydroxyphenyl)phenyl]propanoylamino]butanoyl]amino]-6-oxohexanoic acid |
| SMILES | NC(=O)C(CCCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)CCc1ccc(-c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C26H31N3O8/c27-25(36)20(5-2-6-23(32)33)29-26(37)21(12-14-24(34)35)28-22(31)13-9-16-7-10-17(11-8-16)18-3-1-4-19(30)15-18/h1,3-4,7-8,10-11,15,20-21,30H,2,5-6,9,12-14H2,(H2,27,36)(H,28,31)(H,29,37)(H,32,33)(H,34,35) |
| InChIKey | XGFBEMTUIUNXNU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |