C32H38N4O5 — CID 130215550
(4S)-5-amino-4-[[6-amino-2-[3-[4-(4-phenylphenyl)phenyl]propanoylamino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 130215550) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is (4S)-5-amino-4-[[6-amino-2-[3-[4-(4-phenylphenyl)phenyl]propanoylamino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[[6-amino-2-[3-[4-(4-phenylphenyl)phenyl]propanoylamino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 130215550 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (4S)-5-amino-4-[[6-amino-2-[3-[4-(4-phenylphenyl)phenyl]propanoylamino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)CCc1ccc(-c2ccc(-c3ccccc3)cc2)cc1)C(=O)N[C@@H](CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C32H38N4O5/c33-21-5-4-8-28(32(41)36-27(31(34)40)18-20-30(38)39)35-29(37)19-11-22-9-12-24(13-10-22)26-16-14-25(15-17-26)23-6-2-1-3-7-23/h1-3,6-7,9-10,12-17,27-28H,4-5,8,11,18-21,33H2,(H2,34,40)(H,35,37)(H,36,41)(H,38,39)/t27-,28?/m0/s1 |
| InChIKey | TYSBKRRVVCMKQG-MBMZGMDYSA-N |
| XLogP | 3.40 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|