C27H29N3O7 — CID 50992043
(4S)-5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(2-phenylethynyl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid (PubChem CID 50992043) has the molecular formula C27H29N3O7 and a molecular weight of 507.54 g/mol. Its IUPAC name is (4S)-5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(2-phenylethynyl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(2-phenylethynyl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 50992043 |
| Molecular Formula | C27H29N3O7 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | (4S)-5-amino-4-[[(2S)-4-carboxy-2-[3-[4-(2-phenylethynyl)phenyl]propanoylamino]butanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O7/c28-26(36)21(13-16-24(32)33)30-27(37)22(14-17-25(34)35)29-23(31)15-12-20-10-8-19(9-11-20)7-6-18-4-2-1-3-5-18/h1-5,8-11,21-22H,12-17H2,(H2,28,36)(H,29,31)(H,30,37)(H,32,33)(H,34,35)/t21-,22-/m0/s1 |
| InChIKey | AVFCHUYQSZAIFE-VXKWHMMOSA-N |
| XLogP | 1.20 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|