C27H35N3O5 — CID 152872714
(4S,7R)-11-amino-7-carbamoyl-5-oxo-4-[3-(4-phenylphenyl)propanoylamino]undecanoic acid (PubChem CID 152872714) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is (4S,7R)-11-amino-7-carbamoyl-5-oxo-4-[3-(4-phenylphenyl)propanoylamino]undecanoic acid.
| Compound Name | (4S,7R)-11-amino-7-carbamoyl-5-oxo-4-[3-(4-phenylphenyl)propanoylamino]undecanoic acid |
|---|---|
| PubChem CID | 152872714 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (4S,7R)-11-amino-7-carbamoyl-5-oxo-4-[3-(4-phenylphenyl)propanoylamino]undecanoic acid |
| SMILES | NCCCC[C@H](CC(=O)[C@H](CCC(=O)O)NC(=O)CCc1ccc(-c2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C27H35N3O5/c28-17-5-4-8-22(27(29)35)18-24(31)23(14-16-26(33)34)30-25(32)15-11-19-9-12-21(13-10-19)20-6-2-1-3-7-20/h1-3,6-7,9-10,12-13,22-23H,4-5,8,11,14-18,28H2,(H2,29,35)(H,30,32)(H,33,34)/t22-,23+/m1/s1 |
| InChIKey | TZSGOCKVQPSNMA-PKTZIBPZSA-N |
| XLogP | 2.83 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|