C24H33N3O3S — CID 159158440
(2R,5S)-2-(4-aminobutyl)-4-oxo-5-[3-(4-thiophen-2-ylphenyl)propanoylamino]heptanamide (PubChem CID 159158440) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is (2R,5S)-2-(4-aminobutyl)-4-oxo-5-[3-(4-thiophen-2-ylphenyl)propanoylamino]heptanamide.
| Compound Name | (2R,5S)-2-(4-aminobutyl)-4-oxo-5-[3-(4-thiophen-2-ylphenyl)propanoylamino]heptanamide |
|---|---|
| PubChem CID | 159158440 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (2R,5S)-2-(4-aminobutyl)-4-oxo-5-[3-(4-thiophen-2-ylphenyl)propanoylamino]heptanamide |
| SMILES | CC[C@H](NC(=O)CCc1ccc(-c2cccs2)cc1)C(=O)C[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C24H33N3O3S/c1-2-20(21(28)16-19(24(26)30)6-3-4-14-25)27-23(29)13-10-17-8-11-18(12-9-17)22-7-5-15-31-22/h5,7-9,11-12,15,19-20H,2-4,6,10,13-14,16,25H2,1H3,(H2,26,30)(H,27,29)/t19-,20+/m1/s1 |
| InChIKey | MQZSEFMBQGCDPA-UXHICEINSA-N |
| XLogP | 3.43 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|