C20H25N3O4S — CID 123606799
5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-thiophen-2-ylphenyl)propanoylamino]pentanoic acid (PubChem CID 123606799) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-thiophen-2-ylphenyl)propanoylamino]pentanoic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-thiophen-2-ylphenyl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 123606799 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-thiophen-2-ylphenyl)propanoylamino]pentanoic acid |
| SMILES | NC(=O)CNCC(CCC(=O)O)NC(=O)CCc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c21-18(24)13-22-12-16(8-10-20(26)27)23-19(25)9-5-14-3-6-15(7-4-14)17-2-1-11-28-17/h1-4,6-7,11,16,22H,5,8-10,12-13H2,(H2,21,24)(H,23,25)(H,26,27) |
| InChIKey | HUUBPXZTZGLATO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |