C26H32N2O7 — CID 157378160
(4R,7S)-4-carbamoyl-6-oxo-7-[3-(4-phenylphenyl)propanoylamino]nonanoic acid;formic acid (PubChem CID 157378160) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is (4R,7S)-4-carbamoyl-6-oxo-7-[3-(4-phenylphenyl)propanoylamino]nonanoic acid;formic acid.
| Compound Name | (4R,7S)-4-carbamoyl-6-oxo-7-[3-(4-phenylphenyl)propanoylamino]nonanoic acid;formic acid |
|---|---|
| PubChem CID | 157378160 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (4R,7S)-4-carbamoyl-6-oxo-7-[3-(4-phenylphenyl)propanoylamino]nonanoic acid;formic acid |
| SMILES | CC[C@H](NC(=O)CCc1ccc(-c2ccccc2)cc1)C(=O)CC(CCC(=O)O)C(N)=O.O=CO |
| InChI | InChI=1S/C25H30N2O5.CH2O2/c1-2-21(22(28)16-20(25(26)32)13-15-24(30)31)27-23(29)14-10-17-8-11-19(12-9-17)18-6-4-3-5-7-18;2-1-3/h3-9,11-12,20-21H,2,10,13-16H2,1H3,(H2,26,32)(H,27,29)(H,30,31);1H,(H,2,3)/t20?,21-;/m0./s1 |
| InChIKey | BKODSMZRHSVOAY-NPTNJNKCSA-N |
| XLogP | 2.81 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|