C19H23N3O3S — CID 159584062
(5S)-4-oxo-5-[3-[4-(1,3-thiazol-2-yl)phenyl]propanoylamino]heptanamide (PubChem CID 159584062) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (5S)-4-oxo-5-[3-[4-(1,3-thiazol-2-yl)phenyl]propanoylamino]heptanamide.
| Compound Name | (5S)-4-oxo-5-[3-[4-(1,3-thiazol-2-yl)phenyl]propanoylamino]heptanamide |
|---|---|
| PubChem CID | 159584062 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (5S)-4-oxo-5-[3-[4-(1,3-thiazol-2-yl)phenyl]propanoylamino]heptanamide |
| SMILES | CC[C@H](NC(=O)CCc1ccc(-c2nccs2)cc1)C(=O)CCC(N)=O |
| InChI | InChI=1S/C19H23N3O3S/c1-2-15(16(23)8-9-17(20)24)22-18(25)10-5-13-3-6-14(7-4-13)19-21-11-12-26-19/h3-4,6-7,11-12,15H,2,5,8-10H2,1H3,(H2,20,24)(H,22,25)/t15-/m0/s1 |
| InChIKey | SXAWMPNHHAOZFK-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |