C18H24N2O5 — CID 162172413
(4S)-8-amino-4-[3-(4-methylphenyl)propanoylamino]-5,8-dioxooctanoic acid (PubChem CID 162172413) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is (4S)-8-amino-4-[3-(4-methylphenyl)propanoylamino]-5,8-dioxooctanoic acid.
| Compound Name | (4S)-8-amino-4-[3-(4-methylphenyl)propanoylamino]-5,8-dioxooctanoic acid |
|---|---|
| PubChem CID | 162172413 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (4S)-8-amino-4-[3-(4-methylphenyl)propanoylamino]-5,8-dioxooctanoic acid |
| SMILES | Cc1ccc(CCC(=O)N[C@@H](CCC(=O)O)C(=O)CCC(N)=O)cc1 |
| InChI | InChI=1S/C18H24N2O5/c1-12-2-4-13(5-3-12)6-10-17(23)20-14(7-11-18(24)25)15(21)8-9-16(19)22/h2-5,14H,6-11H2,1H3,(H2,19,22)(H,20,23)(H,24,25)/t14-/m0/s1 |
| InChIKey | IKKNSHDODZHFGM-AWEZNQCLSA-N |
| XLogP | 1.11 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |