C18H25N3O5 — CID 123334302
5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-ethylphenyl)propanoylamino]-5-oxopentanoic acid (PubChem CID 123334302) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-ethylphenyl)propanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-ethylphenyl)propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123334302 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-ethylphenyl)propanoylamino]-5-oxopentanoic acid |
| SMILES | CCc1ccc(CCC(=O)NC(CCC(=O)O)C(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C18H25N3O5/c1-2-12-3-5-13(6-4-12)7-9-16(23)21-14(8-10-17(24)25)18(26)20-11-15(19)22/h3-6,14H,2,7-11H2,1H3,(H2,19,22)(H,20,26)(H,21,23)(H,24,25) |
| InChIKey | XBLNJMGBDZXZBT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |