C25H32N4O4 — CID 15391509
(4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(3-phenylpropanoylamino)pentanoic acid (PubChem CID 15391509) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(3-phenylpropanoylamino)pentanoic acid.
| Compound Name | (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(3-phenylpropanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 15391509 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(3-phenylpropanoylamino)pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCNC(=O)[C@@H](CCC(=O)O)NC(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H32N4O4/c26-24(27)20-12-9-19(10-13-20)8-4-5-17-28-25(33)21(14-16-23(31)32)29-22(30)15-11-18-6-2-1-3-7-18/h1-3,6-7,9-10,12-13,21H,4-5,8,11,14-17H2,(H3,26,27)(H,28,33)(H,29,30)(H,31,32)/t21-/m1/s1 |
| InChIKey | DKHAFTSYZMGOQL-OAQYLSRUSA-N |
| XLogP | 2.39 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|