C27H35N5O5 — CID 54212909
tert-butyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-(2-phenylethylamino)butanoate (PubChem CID 54212909) has the molecular formula C27H35N5O5 and a molecular weight of 509.61 g/mol. Its IUPAC name is tert-butyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-(2-phenylethylamino)butanoate.
| Compound Name | tert-butyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-(2-phenylethylamino)butanoate |
|---|---|
| PubChem CID | 54212909 |
| Molecular Formula | C27H35N5O5 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | tert-butyl 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-(2-phenylethylamino)butanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(CC(=O)OC(C)(C)C)C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H35N5O5/c1-27(2,3)37-24(35)17-21(26(36)30-16-15-18-7-5-4-6-8-18)32-23(34)14-13-22(33)31-20-11-9-19(10-12-20)25(28)29/h4-12,21H,13-17H2,1-3H3,(H3,28,29)(H,30,36)(H,31,33)(H,32,34) |
| InChIKey | PXEFAJVKOGGBMK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|