C22H24N4O6 — CID 57134661
(2S)-2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 57134661) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is (2S)-2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | (2S)-2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 57134661 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2S)-2-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)N[C@@H](CC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H24N4O6/c23-21(24)15-6-8-16(9-7-15)25-18(27)10-11-19(28)26-17(22(30)31)12-20(29)32-13-14-4-2-1-3-5-14/h1-9,17H,10-13H2,(H3,23,24)(H,25,27)(H,26,28)(H,30,31)/t17-/m0/s1 |
| InChIKey | YYICGFZKBBOVFD-KRWDZBQOSA-N |
| XLogP | 1.39 |
| TPSA | 171.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|