C20H20F2N4O4 — CID 57064726
3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-3-(3,5-difluorophenyl)propanoic acid (PubChem CID 57064726) has the molecular formula C20H20F2N4O4 and a molecular weight of 418.40 g/mol. Its IUPAC name is 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-3-(3,5-difluorophenyl)propanoic acid.
| Compound Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-3-(3,5-difluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 57064726 |
| Molecular Formula | C20H20F2N4O4 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-3-(3,5-difluorophenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(CC(=O)O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C20H20F2N4O4/c21-13-7-12(8-14(22)9-13)16(10-19(29)30)26-18(28)6-5-17(27)25-15-3-1-11(2-4-15)20(23)24/h1-4,7-9,16H,5-6,10H2,(H3,23,24)(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | FCEXRHPKHMDOQN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|