C22H25N3O5 — CID 19757354
4-[1-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-carboxyethyl]benzoic acid (PubChem CID 19757354) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 4-[1-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-carboxyethyl]benzoic acid.
| Compound Name | 4-[1-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-carboxyethyl]benzoic acid |
|---|---|
| PubChem CID | 19757354 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[1-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-carboxyethyl]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)NC(CC(=O)O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O5/c23-21(24)16-7-5-14(6-8-16)3-1-2-4-19(26)25-18(13-20(27)28)15-9-11-17(12-10-15)22(29)30/h5-12,18H,1-4,13H2,(H3,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | DUAIJQQZNZCFKD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 153.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|