C26H29N3O3 — CID 19757318
3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-naphthalen-1-ylbutanoic acid (PubChem CID 19757318) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-naphthalen-1-ylbutanoic acid.
| Compound Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-naphthalen-1-ylbutanoic acid |
|---|---|
| PubChem CID | 19757318 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-4-naphthalen-1-ylbutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)NC(CC(=O)O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H29N3O3/c27-26(28)20-14-12-18(13-15-20)6-1-4-11-24(30)29-22(17-25(31)32)16-21-9-5-8-19-7-2-3-10-23(19)21/h2-3,5,7-10,12-15,22H,1,4,6,11,16-17H2,(H3,27,28)(H,29,30)(H,31,32) |
| InChIKey | CIQKXRAQACSHHQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|