C23H29N3O5 — CID 19757362
3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(2,4-dimethoxyphenyl)propanoic acid (PubChem CID 19757362) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(2,4-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(2,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 19757362 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 3-[5-(4-carbamimidoylphenyl)pentanoylamino]-3-(2,4-dimethoxyphenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)NC(CC(=O)O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C23H29N3O5/c1-30-17-11-12-18(20(13-17)31-2)19(14-22(28)29)26-21(27)6-4-3-5-15-7-9-16(10-8-15)23(24)25/h7-13,19H,3-6,14H2,1-2H3,(H3,24,25)(H,26,27)(H,28,29) |
| InChIKey | DOTNCFVICZLAQT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|