C19H27NO7 — CID 120532029
3-(2,4-dimethoxyphenyl)-3-[3-(oxan-4-yloxy)propanoylamino]propanoic acid (PubChem CID 120532029) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-[3-(oxan-4-yloxy)propanoylamino]propanoic acid.
| Compound Name | 3-(2,4-dimethoxyphenyl)-3-[3-(oxan-4-yloxy)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 120532029 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3-[3-(oxan-4-yloxy)propanoylamino]propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NC(=O)CCOC2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C19H27NO7/c1-24-14-3-4-15(17(11-14)25-2)16(12-19(22)23)20-18(21)7-10-27-13-5-8-26-9-6-13/h3-4,11,13,16H,5-10,12H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | YZTSQJLYCCPESB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |