C15H21NO5 — CID 64526958
3-(2,4-dimethoxyphenyl)-3-morpholin-4-ylpropanoic acid (PubChem CID 64526958) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-3-morpholin-4-ylpropanoic acid.
| Compound Name | 3-(2,4-dimethoxyphenyl)-3-morpholin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 64526958 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-3-morpholin-4-ylpropanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C15H21NO5/c1-19-11-3-4-12(14(9-11)20-2)13(10-15(17)18)16-5-7-21-8-6-16/h3-4,9,13H,5-8,10H2,1-2H3,(H,17,18) |
| InChIKey | YGSXNVFBIRUKDV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |