(2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid

C16H23NO4 — CID 93464327

IUPAC(2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid
SMILESCOc1ccc([C@@H](C(=O)O)N2CCCCCC2)c(OC)c1
InChIInChI=1S/C16H23NO4/c1-20-12-7-8-13(14(11-12)21-2)15(16(18)19)17-9-5-3-4-6-10-17/h7-8,11,15H,3-6,9-10H2,1-2H3,(H,18,19)/t15-/m0/s1
InChIKeyHHMLIZGYQSJKPU-HNNXBMFYSA-N
MW293.36 g/mol
LogP2.71
Rot. Bonds5

About (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid

(2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid (PubChem CID 93464327) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid.

Molecular Properties

Compound Name(2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid
PubChem CID93464327
Molecular FormulaC16H23NO4
Molecular Weight293.36 g/mol
Exact Mass293.16
IUPAC Name(2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid
SMILESCOc1ccc([C@@H](C(=O)O)N2CCCCCC2)c(OC)c1
InChIInChI=1S/C16H23NO4/c1-20-12-7-8-13(14(11-12)21-2)15(16(18)19)17-9-5-3-4-6-10-17/h7-8,11,15H,3-6,9-10H2,1-2H3,(H,18,19)/t15-/m0/s1
InChIKeyHHMLIZGYQSJKPU-HNNXBMFYSA-N
XLogP2.71
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.36
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid?
The IUPAC name of (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid (CID 93464327) is (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid.
What is the SMILES notation for (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid?
The canonical SMILES for (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid is COc1ccc([C@@H](C(=O)O)N2CCCCCC2)c(OC)c1.
What is the InChIKey of (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid?
The InChIKey is HHMLIZGYQSJKPU-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-20-12-7-8-13(14(11-12)21-2)15(16(18)19)17-9-5-3-4-6-10-17/h7-8,11,15H,3-6,9-10H2,1-2H3,(H,18,19)/t15-/m0/s1.
What are the key properties of (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid?
(2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid has a molecular weight of 293.36 g/mol, XLogP of 2.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(azepan-1-yl)-2-(2,4-dimethoxyphenyl)acetic acid is sourced from PubChem (CID 93464327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).