C15H22ClNO2 — CID 82215428
1-[2-chloro-2-(2,4-dimethoxyphenyl)ethyl]piperidine (PubChem CID 82215428) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-[2-chloro-2-(2,4-dimethoxyphenyl)ethyl]piperidine.
| Compound Name | 1-[2-chloro-2-(2,4-dimethoxyphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 82215428 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-[2-chloro-2-(2,4-dimethoxyphenyl)ethyl]piperidine |
| SMILES | COc1ccc(C(Cl)CN2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C15H22ClNO2/c1-18-12-6-7-13(15(10-12)19-2)14(16)11-17-8-4-3-5-9-17/h6-7,10,14H,3-5,8-9,11H2,1-2H3 |
| InChIKey | ANPFNCVDDGJQSJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|