C11H12ClF3O2 — CID 61085585
1-(1-chloro-3,3,3-trifluoropropyl)-2,4-dimethoxybenzene (PubChem CID 61085585) has the molecular formula C11H12ClF3O2 and a molecular weight of 268.66 g/mol. Its IUPAC name is 1-(1-chloro-3,3,3-trifluoropropyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(1-chloro-3,3,3-trifluoropropyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 61085585 |
| Molecular Formula | C11H12ClF3O2 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(1-chloro-3,3,3-trifluoropropyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(C(Cl)CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C11H12ClF3O2/c1-16-7-3-4-8(10(5-7)17-2)9(12)6-11(13,14)15/h3-5,9H,6H2,1-2H3 |
| InChIKey | CHAMBEKYAFCAES-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|