C15H12ClF3O2 — CID 103304043
1-[chloro-(2,4-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103304043) has the molecular formula C15H12ClF3O2 and a molecular weight of 316.71 g/mol. Its IUPAC name is 1-[chloro-(2,4-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[chloro-(2,4-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103304043 |
| Molecular Formula | C15H12ClF3O2 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-[chloro-(2,4-dimethoxyphenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | COc1ccc(C(Cl)c2cc(F)c(F)cc2F)c(OC)c1 |
| InChI | InChI=1S/C15H12ClF3O2/c1-20-8-3-4-9(14(5-8)21-2)15(16)10-6-12(18)13(19)7-11(10)17/h3-7,15H,1-2H3 |
| InChIKey | WDNSDTLEQYNDJY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|