C12H16ClFO — CID 61084063
1-(1-chloro-2,2-dimethylpropyl)-2-fluoro-4-methoxybenzene (PubChem CID 61084063) has the molecular formula C12H16ClFO and a molecular weight of 230.71 g/mol. Its IUPAC name is 1-(1-chloro-2,2-dimethylpropyl)-2-fluoro-4-methoxybenzene.
| Compound Name | 1-(1-chloro-2,2-dimethylpropyl)-2-fluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 61084063 |
| Molecular Formula | C12H16ClFO |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(1-chloro-2,2-dimethylpropyl)-2-fluoro-4-methoxybenzene |
| SMILES | COc1ccc(C(Cl)C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C12H16ClFO/c1-12(2,3)11(13)9-6-5-8(15-4)7-10(9)14/h5-7,11H,1-4H3 |
| InChIKey | XXSULGPLVQKZJC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|