C14H14ClFOS — CID 102884472
3-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-2,5-dimethylthiophene (PubChem CID 102884472) has the molecular formula C14H14ClFOS and a molecular weight of 284.78 g/mol. Its IUPAC name is 3-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-2,5-dimethylthiophene.
| Compound Name | 3-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 102884472 |
| Molecular Formula | C14H14ClFOS |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-[chloro-(2-fluoro-4-methoxyphenyl)methyl]-2,5-dimethylthiophene |
| SMILES | COc1ccc(C(Cl)c2cc(C)sc2C)c(F)c1 |
| InChI | InChI=1S/C14H14ClFOS/c1-8-6-12(9(2)18-8)14(15)11-5-4-10(17-3)7-13(11)16/h4-7,14H,1-3H3 |
| InChIKey | DIFYLCUNKXFYPG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|