C15H18O3S — CID 61089487
(2,4-dimethoxyphenyl)-(2,5-dimethylthiophen-3-yl)methanol (PubChem CID 61089487) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(2,5-dimethylthiophen-3-yl)methanol.
| Compound Name | (2,4-dimethoxyphenyl)-(2,5-dimethylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 61089487 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(2,5-dimethylthiophen-3-yl)methanol |
| SMILES | COc1ccc(C(O)c2cc(C)sc2C)c(OC)c1 |
| InChI | InChI=1S/C15H18O3S/c1-9-7-13(10(2)19-9)15(16)12-6-5-11(17-3)8-14(12)18-4/h5-8,15-16H,1-4H3 |
| InChIKey | FXRQGFZETONBDV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |